C11H18F4N2 — CID 154937055
3,3-dimethyl-4-N-(2,2,3,3-tetrafluorobutyl)penta-1,4-diene-2,4-diamine (PubChem CID 154937055) has the molecular formula C11H18F4N2 and a molecular weight of 254.27 g/mol. Its IUPAC name is 3,3-dimethyl-4-N-(2,2,3,3-tetrafluorobutyl)penta-1,4-diene-2,4-diamine.
| Compound Name | 3,3-dimethyl-4-N-(2,2,3,3-tetrafluorobutyl)penta-1,4-diene-2,4-diamine |
|---|---|
| PubChem CID | 154937055 |
| Molecular Formula | C11H18F4N2 |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 3,3-dimethyl-4-N-(2,2,3,3-tetrafluorobutyl)penta-1,4-diene-2,4-diamine |
| SMILES | C=C(N)C(C)(C)C(=C)NCC(F)(F)C(C)(F)F |
| InChI | InChI=1S/C11H18F4N2/c1-7(16)9(3,4)8(2)17-6-11(14,15)10(5,12)13/h17H,1-2,6,16H2,3-5H3 |
| InChIKey | WZXOKYNCFJFENU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|