C34H36N4O4S2 — CID 154937068
3-cyano-4-[1-pentoxy-4-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)butan-2-yl]oxy-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide (PubChem CID 154937068) has the molecular formula C34H36N4O4S2 and a molecular weight of 628.82 g/mol. Its IUPAC name is 3-cyano-4-[1-pentoxy-4-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)butan-2-yl]oxy-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide.
| Compound Name | 3-cyano-4-[1-pentoxy-4-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)butan-2-yl]oxy-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 154937068 |
| Molecular Formula | C34H36N4O4S2 |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | 3-cyano-4-[1-pentoxy-4-(1-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl)butan-2-yl]oxy-N-(1,2,4-thiadiazol-5-yl)benzenesulfonamide |
| SMILES | CCCCCOCC(CCC12CCC(c3ccccc31)c1ccccc12)Oc1ccc(S(=O)(=O)Nc2ncns2)cc1C#N |
| InChI | InChI=1S/C34H36N4O4S2/c1-2-3-8-19-41-22-25(42-32-14-13-26(20-24(32)21-35)44(39,40)38-33-36-23-37-43-33)15-17-34-18-16-27(28-9-4-6-11-30(28)34)29-10-5-7-12-31(29)34/h4-7,9-14,20,23,25,27H,2-3,8,15-19,22H2,1H3,(H,36,37,38) |
| InChIKey | NUKLFHVIWHLVOL-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 114.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|