About N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine
N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine (PubChem CID 154937187) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine.
Molecular Properties
| Compound Name | N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine |
| PubChem CID | 154937187 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine |
| SMILES | C=CCC(/C=C\C)N(C)CNC |
| InChI | InChI=1S/C10H20N2/c1-5-7-10(8-6-2)12(4)9-11-3/h5-6,8,10-11H,1,7,9H2,2-4H3/b8-6- |
| InChIKey | SZSRJCDEOPSSHI-VURMDHGXSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine?
The IUPAC name of N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine (CID 154937187) is N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine.
What is the SMILES notation for N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine?
The canonical SMILES for N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine is C=CCC(/C=C\C)N(C)CNC.
What is the InChIKey of N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine?
The InChIKey is SZSRJCDEOPSSHI-VURMDHGXSA-N. The full InChI is InChI=1S/C10H20N2/c1-5-7-10(8-6-2)12(4)9-11-3/h5-6,8,10-11H,1,7,9H2,2-4H3/b8-6-.
What are the key properties of N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine?
N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine has a molecular weight of 168.28 g/mol, XLogP of 1.62, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(5Z)-hepta-1,5-dien-4-yl]-N,N'-dimethylmethanediamine is sourced from PubChem (CID 154937187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).