C20H34N2 — CID 154937341
(Z)-N'-(2,2-dimethylcyclobutyl)-2-methyl-N-[(7Z)-nona-1,7-dien-2-yl]but-2-enimidamide (PubChem CID 154937341) has the molecular formula C20H34N2 and a molecular weight of 302.51 g/mol. Its IUPAC name is (Z)-N'-(2,2-dimethylcyclobutyl)-2-methyl-N-[(7Z)-nona-1,7-dien-2-yl]but-2-enimidamide.
| Compound Name | (Z)-N'-(2,2-dimethylcyclobutyl)-2-methyl-N-[(7Z)-nona-1,7-dien-2-yl]but-2-enimidamide |
|---|---|
| PubChem CID | 154937341 |
| Molecular Formula | C20H34N2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.27 |
| IUPAC Name | (Z)-N'-(2,2-dimethylcyclobutyl)-2-methyl-N-[(7Z)-nona-1,7-dien-2-yl]but-2-enimidamide |
| SMILES | C=C(CCCC/C=C\C)NC(=N/C1CCC1(C)C)/C(C)=C\C |
| InChI | InChI=1S/C20H34N2/c1-7-9-10-11-12-13-17(4)21-19(16(3)8-2)22-18-14-15-20(18,5)6/h7-9,18H,4,10-15H2,1-3,5-6H3,(H,21,22)/b9-7-,16-8- |
| InChIKey | KOLHHOYEJDORDT-BIHOSGGPSA-N |
| XLogP | 5.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|