C21H24F3N5O2S — CID 154937544
(2R)-1-[2-(4-aminophenyl)ethyl]-7-[(1S)-4-methyl-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-2-sulfanyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyrimidin-5-one (PubChem CID 154937544) has the molecular formula C21H24F3N5O2S and a molecular weight of 467.52 g/mol. Its IUPAC name is (2R)-1-[2-(4-aminophenyl)ethyl]-7-[(1S)-4-methyl-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-2-sulfanyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyrimidin-5-one.
| Compound Name | (2R)-1-[2-(4-aminophenyl)ethyl]-7-[(1S)-4-methyl-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-2-sulfanyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 154937544 |
| Molecular Formula | C21H24F3N5O2S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (2R)-1-[2-(4-aminophenyl)ethyl]-7-[(1S)-4-methyl-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-2-sulfanyl-2-(trifluoromethyl)-3H-imidazo[1,2-a]pyrimidin-5-one |
| SMILES | CC12CO[C@H](CN1c1cc(=O)n3c(n1)N(CCc1ccc(N)cc1)[C@](S)(C(F)(F)F)C3)C2 |
| InChI | InChI=1S/C21H24F3N5O2S/c1-19-9-15(31-12-19)10-29(19)16-8-17(30)27-11-20(32,21(22,23)24)28(18(27)26-16)7-6-13-2-4-14(25)5-3-13/h2-5,8,15,32H,6-7,9-12,25H2,1H3/t15-,19?,20+/m0/s1 |
| InChIKey | KVMROQQHMNTBGS-DVLXCBSQSA-N |
| XLogP | 2.44 |
| TPSA | 76.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|