C22H35N3O6 — CID 154938177
5-[(3aR,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-hydroxy-2-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyliminomethyl]cyclohex-2-en-1-one (PubChem CID 154938177) has the molecular formula C22H35N3O6 and a molecular weight of 437.54 g/mol. Its IUPAC name is 5-[(3aR,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-hydroxy-2-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyliminomethyl]cyclohex-2-en-1-one.
| Compound Name | 5-[(3aR,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-hydroxy-2-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyliminomethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 154938177 |
| Molecular Formula | C22H35N3O6 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 5-[(3aR,4R,6aS)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-hydroxy-2-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyliminomethyl]cyclohex-2-en-1-one |
| SMILES | CC1(C)O[C@H]2[C@H](CO[C@@H]2C2CC(=O)C(/C=N/CCN3CCN(CCO)CC3)=C(O)C2)O1 |
| InChI | InChI=1S/C22H35N3O6/c1-22(2)30-19-14-29-20(21(19)31-22)15-11-17(27)16(18(28)12-15)13-23-3-4-24-5-7-25(8-6-24)9-10-26/h13,15,19-21,26-27H,3-12,14H2,1-2H3/b23-13+/t15?,19-,20+,21-/m0/s1 |
| InChIKey | CLAFQXWBRYBDPT-YGYLFXTMSA-N |
| XLogP | 0.38 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|