C13H16O3 — CID 154938203
(7S)-10,12-dioxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-11-one (PubChem CID 154938203) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (7S)-10,12-dioxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-11-one.
| Compound Name | (7S)-10,12-dioxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-11-one |
|---|---|
| PubChem CID | 154938203 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (7S)-10,12-dioxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecan-11-one |
| SMILES | O=C1OC2C3CC(C2O1)[C@H]1C2CCC(C2)C31 |
| InChI | InChI=1S/C13H16O3/c14-13-15-11-7-4-8(12(11)16-13)10-6-2-1-5(3-6)9(7)10/h5-12H,1-4H2/t5?,6?,7?,8?,9-,10?,11?,12?/m1/s1 |
| InChIKey | ISHIRDFFSYJRSH-QDEJXFNLSA-N |
| XLogP | 2.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|