C22H31N5O3 — CID 154938219
(2Z)-3-hydroxy-2-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethylamino]methylidene]-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)cyclohexan-1-one (PubChem CID 154938219) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is (2Z)-3-hydroxy-2-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethylamino]methylidene]-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)cyclohexan-1-one.
| Compound Name | (2Z)-3-hydroxy-2-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethylamino]methylidene]-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 154938219 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | (2Z)-3-hydroxy-2-[[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethylamino]methylidene]-5-(1H-pyrrolo[2,3-b]pyridin-4-yl)cyclohexan-1-one |
| SMILES | O=C1CC(c2ccnc3[nH]ccc23)CC(O)/C1=C/NCCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C22H31N5O3/c28-12-11-27-9-7-26(8-10-27)6-5-23-15-19-20(29)13-16(14-21(19)30)17-1-3-24-22-18(17)2-4-25-22/h1-4,15-16,20,23,28-29H,5-14H2,(H,24,25)/b19-15- |
| InChIKey | GVYMXXBXHSXBKB-CYVLTUHYSA-N |
| XLogP | 0.45 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|