About N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide
N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide (PubChem CID 154939276) has the molecular formula C9H22N4
and a molecular weight of 186.30 g/mol. Its IUPAC name is N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide.
Molecular Properties
| Compound Name | N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide |
| PubChem CID | 154939276 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide |
| SMILES | CCCCN(C)/C(=N\NN)C(C)C |
| InChI | InChI=1S/C9H22N4/c1-5-6-7-13(4)9(8(2)3)11-12-10/h8,12H,5-7,10H2,1-4H3/b11-9- |
| InChIKey | HINFCGHWKUQIKW-LUAWRHEFSA-N |
| XLogP | 1.15 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide?
The IUPAC name of N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide (CID 154939276) is N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide.
What is the SMILES notation for N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide?
The canonical SMILES for N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide is CCCCN(C)/C(=N\NN)C(C)C.
What is the InChIKey of N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide?
The InChIKey is HINFCGHWKUQIKW-LUAWRHEFSA-N. The full InChI is InChI=1S/C9H22N4/c1-5-6-7-13(4)9(8(2)3)11-12-10/h8,12H,5-7,10H2,1-4H3/b11-9-.
What are the key properties of N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide?
N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide has a molecular weight of 186.30 g/mol, XLogP of 1.15, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N'-hydrazinyl-N,2-dimethylpropanimidamide is sourced from PubChem (CID 154939276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).