C25H26FN9O2S — CID 154939499
N-[[7-[(3-fluoro-2-pyridinyl)methylamino]-2-[2-[2-(6-methyl-1H-benzimidazol-2-yl)ethylamino]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-5-yl]oxy]acetamide (PubChem CID 154939499) has the molecular formula C25H26FN9O2S and a molecular weight of 535.61 g/mol. Its IUPAC name is N-[[7-[(3-fluoro-2-pyridinyl)methylamino]-2-[2-[2-(6-methyl-1H-benzimidazol-2-yl)ethylamino]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-5-yl]oxy]acetamide.
| Compound Name | N-[[7-[(3-fluoro-2-pyridinyl)methylamino]-2-[2-[2-(6-methyl-1H-benzimidazol-2-yl)ethylamino]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-5-yl]oxy]acetamide |
|---|---|
| PubChem CID | 154939499 |
| Molecular Formula | C25H26FN9O2S |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | N-[[7-[(3-fluoro-2-pyridinyl)methylamino]-2-[2-[2-(6-methyl-1H-benzimidazol-2-yl)ethylamino]ethyl]-[1,3]thiazolo[5,4-d]pyrimidin-5-yl]oxy]acetamide |
| SMILES | CC(=O)NOc1nc(NCc2ncccc2F)c2nc(CCNCCc3nc4ccc(C)cc4[nH]3)sc2n1 |
| InChI | InChI=1S/C25H26FN9O2S/c1-14-5-6-17-18(12-14)31-20(30-17)7-10-27-11-8-21-32-22-23(29-13-19-16(26)4-3-9-28-19)33-25(34-24(22)38-21)37-35-15(2)36/h3-6,9,12,27H,7-8,10-11,13H2,1-2H3,(H,30,31)(H,35,36)(H,29,33,34) |
| InChIKey | OUIHEBNERANREF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 142.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|