About (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine
(3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine (PubChem CID 154939520) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine.
Molecular Properties
| Compound Name | (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine |
| PubChem CID | 154939520 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine |
| SMILES | C=C/C(=C\C/C=N/C=C\C(=C)C)OC |
| InChI | InChI=1S/C12H17NO/c1-5-12(14-4)7-6-9-13-10-8-11(2)3/h5,7-10H,1-2,6H2,3-4H3/b10-8-,12-7+,13-9+ |
| InChIKey | NHUIMHOOHSQWKI-JAAGJCORSA-N |
| XLogP | 3.25 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine?
The IUPAC name of (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine (CID 154939520) is (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine.
What is the SMILES notation for (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine?
The canonical SMILES for (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine is C=C/C(=C\C/C=N/C=C\C(=C)C)OC.
What is the InChIKey of (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine?
The InChIKey is NHUIMHOOHSQWKI-JAAGJCORSA-N. The full InChI is InChI=1S/C12H17NO/c1-5-12(14-4)7-6-9-13-10-8-11(2)3/h5,7-10H,1-2,6H2,3-4H3/b10-8-,12-7+,13-9+.
What are the key properties of (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine?
(3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine has a molecular weight of 191.27 g/mol, XLogP of 3.25, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-methoxy-N-[(1Z)-3-methylbuta-1,3-dienyl]hexa-3,5-dien-1-imine is sourced from PubChem (CID 154939520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).