About (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene
(4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene (PubChem CID 154939574) has the molecular formula C21H22BrCl
and a molecular weight of 389.76 g/mol. Its IUPAC name is (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene.
Molecular Properties
| Compound Name | (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene |
| PubChem CID | 154939574 |
| Molecular Formula | C21H22BrCl |
| Molecular Weight | 389.76 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene |
| SMILES | CC/C=C1/CC(c2ccc(Br)c(CC)c2)Cc2c(Cl)cccc21 |
| InChI | InChI=1S/C21H22BrCl/c1-3-6-16-12-17(13-19-18(16)7-5-8-21(19)23)15-9-10-20(22)14(4-2)11-15/h5-11,17H,3-4,12-13H2,1-2H3/b16-6- |
| InChIKey | JQBOKFYTBMSMII-SOFYXZRVSA-N |
| XLogP | 7.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.76 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene?
The IUPAC name of (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene (CID 154939574) is (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene.
What is the SMILES notation for (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene?
The canonical SMILES for (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene is CC/C=C1/CC(c2ccc(Br)c(CC)c2)Cc2c(Cl)cccc21.
What is the InChIKey of (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene?
The InChIKey is JQBOKFYTBMSMII-SOFYXZRVSA-N. The full InChI is InChI=1S/C21H22BrCl/c1-3-6-16-12-17(13-19-18(16)7-5-8-21(19)23)15-9-10-20(22)14(4-2)11-15/h5-11,17H,3-4,12-13H2,1-2H3/b16-6-.
What are the key properties of (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene?
(4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene has a molecular weight of 389.76 g/mol, XLogP of 7.19, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2-(4-bromo-3-ethylphenyl)-8-chloro-4-propylidene-2,3-dihydro-1H-naphthalene is sourced from PubChem (CID 154939574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).