C31H36ClN7O3 — CID 154939705
2-[[2-(2-chlorophenoxy)-1-[1-(2-cyanoethyl)tetrazol-5-yl]ethyl]-propylamino]-N-[(2E,4E)-6-methyl-5-phenoxyhepta-2,4,6-trien-2-yl]acetamide (PubChem CID 154939705) has the molecular formula C31H36ClN7O3 and a molecular weight of 590.13 g/mol. Its IUPAC name is 2-[[2-(2-chlorophenoxy)-1-[1-(2-cyanoethyl)tetrazol-5-yl]ethyl]-propylamino]-N-[(2E,4E)-6-methyl-5-phenoxyhepta-2,4,6-trien-2-yl]acetamide.
| Compound Name | 2-[[2-(2-chlorophenoxy)-1-[1-(2-cyanoethyl)tetrazol-5-yl]ethyl]-propylamino]-N-[(2E,4E)-6-methyl-5-phenoxyhepta-2,4,6-trien-2-yl]acetamide |
|---|---|
| PubChem CID | 154939705 |
| Molecular Formula | C31H36ClN7O3 |
| Molecular Weight | 590.13 g/mol |
| Exact Mass | 589.26 |
| IUPAC Name | 2-[[2-(2-chlorophenoxy)-1-[1-(2-cyanoethyl)tetrazol-5-yl]ethyl]-propylamino]-N-[(2E,4E)-6-methyl-5-phenoxyhepta-2,4,6-trien-2-yl]acetamide |
| SMILES | C=C(C)/C(=C\C=C(/C)NC(=O)CN(CCC)C(COc1ccccc1Cl)c1nnnn1CCC#N)Oc1ccccc1 |
| InChI | InChI=1S/C31H36ClN7O3/c1-5-19-38(21-30(40)34-24(4)16-17-28(23(2)3)42-25-12-7-6-8-13-25)27(22-41-29-15-10-9-14-26(29)32)31-35-36-37-39(31)20-11-18-33/h6-10,12-17,27H,2,5,11,19-22H2,1,3-4H3,(H,34,40)/b24-16+,28-17+ |
| InChIKey | SDXGYFQZYJQHHM-PNYPJNSXSA-N |
| XLogP | 5.63 |
| TPSA | 118.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.13 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|