C31H32F2N6O4 — CID 154939870
N-[4-[[7-(2,6-difluoro-3,5-dimethoxybenzoyl)-6-[2-(dimethylamino)ethylamino]isoquinolin-3-yl]amino]-5-methyl-3-pyridinyl]prop-2-enamide (PubChem CID 154939870) has the molecular formula C31H32F2N6O4 and a molecular weight of 590.63 g/mol. Its IUPAC name is N-[4-[[7-(2,6-difluoro-3,5-dimethoxybenzoyl)-6-[2-(dimethylamino)ethylamino]isoquinolin-3-yl]amino]-5-methyl-3-pyridinyl]prop-2-enamide.
| Compound Name | N-[4-[[7-(2,6-difluoro-3,5-dimethoxybenzoyl)-6-[2-(dimethylamino)ethylamino]isoquinolin-3-yl]amino]-5-methyl-3-pyridinyl]prop-2-enamide |
|---|---|
| PubChem CID | 154939870 |
| Molecular Formula | C31H32F2N6O4 |
| Molecular Weight | 590.63 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | N-[4-[[7-(2,6-difluoro-3,5-dimethoxybenzoyl)-6-[2-(dimethylamino)ethylamino]isoquinolin-3-yl]amino]-5-methyl-3-pyridinyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cncc(C)c1Nc1cc2cc(NCCN(C)C)c(C(=O)c3c(F)c(OC)cc(OC)c3F)cc2cn1 |
| InChI | InChI=1S/C31H32F2N6O4/c1-7-26(40)37-22-16-34-14-17(2)30(22)38-25-12-18-11-21(35-8-9-39(3)4)20(10-19(18)15-36-25)31(41)27-28(32)23(42-5)13-24(43-6)29(27)33/h7,10-16,35H,1,8-9H2,2-6H3,(H,37,40)(H,34,36,38) |
| InChIKey | POTJDZSZCKAZAM-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.63 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|