About 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide
2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide (PubChem CID 154940442) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide |
| PubChem CID | 154940442 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide |
| SMILES | CNC(=O)C(CO)(CC(C)(C)C)C(C)C |
| InChI | InChI=1S/C12H25NO2/c1-9(2)12(8-14,10(15)13-6)7-11(3,4)5/h9,14H,7-8H2,1-6H3,(H,13,15) |
| InChIKey | SRFCABYMQVBLFS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide?
The IUPAC name of 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide (CID 154940442) is 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide.
What is the SMILES notation for 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide?
The canonical SMILES for 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide is CNC(=O)C(CO)(CC(C)(C)C)C(C)C.
What is the InChIKey of 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide?
The InChIKey is SRFCABYMQVBLFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO2/c1-9(2)12(8-14,10(15)13-6)7-11(3,4)5/h9,14H,7-8H2,1-6H3,(H,13,15).
What are the key properties of 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide?
2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide has a molecular weight of 215.34 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-N,4,4-trimethyl-2-propan-2-ylpentanamide is sourced from PubChem (CID 154940442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).