C45H24F9N3O3 — CID 154940540
10-[3,5-di(phenoxazin-10-yl)-2,4,6-tris(trifluoromethyl)phenyl]phenoxazine (PubChem CID 154940540) has the molecular formula C45H24F9N3O3 and a molecular weight of 825.69 g/mol. Its IUPAC name is 10-[3,5-di(phenoxazin-10-yl)-2,4,6-tris(trifluoromethyl)phenyl]phenoxazine.
| Compound Name | 10-[3,5-di(phenoxazin-10-yl)-2,4,6-tris(trifluoromethyl)phenyl]phenoxazine |
|---|---|
| PubChem CID | 154940540 |
| Molecular Formula | C45H24F9N3O3 |
| Molecular Weight | 825.69 g/mol |
| Exact Mass | 825.17 |
| IUPAC Name | 10-[3,5-di(phenoxazin-10-yl)-2,4,6-tris(trifluoromethyl)phenyl]phenoxazine |
| SMILES | FC(F)(F)c1c(N2c3ccccc3Oc3ccccc32)c(C(F)(F)F)c(N2c3ccccc3Oc3ccccc32)c(C(F)(F)F)c1N1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C45H24F9N3O3/c46-43(47,48)37-40(55-25-13-1-7-19-31(25)58-32-20-8-2-14-26(32)55)38(44(49,50)51)42(57-29-17-5-11-23-35(29)60-36-24-12-6-18-30(36)57)39(45(52,53)54)41(37)56-27-15-3-9-21-33(27)59-34-22-10-4-16-28(34)56/h1-24H |
| InChIKey | SQGPLCPXZRJIAT-UHFFFAOYSA-N |
| XLogP | 15.47 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.69 |
| LogP ≤ 5 | 15.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |