C20H31NO2 — CID 154941105
3-hexyl-4-(5,6,7,8-tetrahydronaphthalen-1-yloxy)morpholine (PubChem CID 154941105) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 3-hexyl-4-(5,6,7,8-tetrahydronaphthalen-1-yloxy)morpholine.
| Compound Name | 3-hexyl-4-(5,6,7,8-tetrahydronaphthalen-1-yloxy)morpholine |
|---|---|
| PubChem CID | 154941105 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 3-hexyl-4-(5,6,7,8-tetrahydronaphthalen-1-yloxy)morpholine |
| SMILES | CCCCCCC1COCCN1Oc1cccc2c1CCCC2 |
| InChI | InChI=1S/C20H31NO2/c1-2-3-4-5-11-18-16-22-15-14-21(18)23-20-13-8-10-17-9-6-7-12-19(17)20/h8,10,13,18H,2-7,9,11-12,14-16H2,1H3 |
| InChIKey | SPBOABCMMAHPAX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|