About 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide
5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide (PubChem CID 154941596) has the molecular formula C9H10N4O2S2
and a molecular weight of 270.34 g/mol. Its IUPAC name is 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide.
Molecular Properties
| Compound Name | 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide |
| PubChem CID | 154941596 |
| Molecular Formula | C9H10N4O2S2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nnc(NCc2ccccc2)s1 |
| InChI | InChI=1S/C9H10N4O2S2/c10-17(14,15)9-13-12-8(16-9)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12)(H2,10,14,15) |
| InChIKey | CDEDQURFKQEOFI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide?
The IUPAC name of 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide (CID 154941596) is 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide.
What is the SMILES notation for 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide?
The canonical SMILES for 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide is NS(=O)(=O)c1nnc(NCc2ccccc2)s1.
What is the InChIKey of 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide?
The InChIKey is CDEDQURFKQEOFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2S2/c10-17(14,15)9-13-12-8(16-9)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12)(H2,10,14,15).
What are the key properties of 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide?
5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide has a molecular weight of 270.34 g/mol, XLogP of 0.80, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzylamino)-1,3,4-thiadiazole-2-sulfonamide is sourced from PubChem (CID 154941596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).