C18H23N3O4 — CID 154941996
4-[3-[cyano-(3-ethoxy-3-oxopropyl)amino]phenyl]piperidine-1-carboxylic acid (PubChem CID 154941996) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 4-[3-[cyano-(3-ethoxy-3-oxopropyl)amino]phenyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[3-[cyano-(3-ethoxy-3-oxopropyl)amino]phenyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154941996 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 4-[3-[cyano-(3-ethoxy-3-oxopropyl)amino]phenyl]piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)CCN(C#N)c1cccc(C2CCN(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C18H23N3O4/c1-2-25-17(22)8-11-21(13-19)16-5-3-4-15(12-16)14-6-9-20(10-7-14)18(23)24/h3-5,12,14H,2,6-11H2,1H3,(H,23,24) |
| InChIKey | LFQLCOUDLRQWBS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|