ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate

C9H12N2O3 — CID 154942155

IUPACethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate
SMILESCCOC(=O)c1c(C)nc(C)[nH]c1=O
InChIInChI=1S/C9H12N2O3/c1-4-14-9(13)7-5(2)10-6(3)11-8(7)12/h4H2,1-3H3,(H,10,11,12)
InChIKeyIWXGTBAAQXYOTG-UHFFFAOYSA-N
MW196.21 g/mol
LogP0.56
Rot. Bonds2

About ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate

ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 154942155) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate.

Molecular Properties

Compound Nameethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate
PubChem CID154942155
Molecular FormulaC9H12N2O3
Molecular Weight196.21 g/mol
Exact Mass196.08
IUPAC Nameethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate
SMILESCCOC(=O)c1c(C)nc(C)[nH]c1=O
InChIInChI=1S/C9H12N2O3/c1-4-14-9(13)7-5(2)10-6(3)11-8(7)12/h4H2,1-3H3,(H,10,11,12)
InChIKeyIWXGTBAAQXYOTG-UHFFFAOYSA-N
XLogP0.56
TPSA72.05 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.21
LogP ≤ 50.56
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate?
The IUPAC name of ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate (CID 154942155) is ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate.
What is the SMILES notation for ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate?
The canonical SMILES for ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate is CCOC(=O)c1c(C)nc(C)[nH]c1=O.
What is the InChIKey of ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate?
The InChIKey is IWXGTBAAQXYOTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3/c1-4-14-9(13)7-5(2)10-6(3)11-8(7)12/h4H2,1-3H3,(H,10,11,12).
What are the key properties of ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate?
ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate has a molecular weight of 196.21 g/mol, XLogP of 0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,4-dimethyl-6-oxo-1H-pyrimidine-5-carboxylate is sourced from PubChem (CID 154942155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).