About 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid
1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid (PubChem CID 154944010) has the molecular formula C26H50O6
and a molecular weight of 458.68 g/mol. Its IUPAC name is 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid.
Molecular Properties
| Compound Name | 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid |
| PubChem CID | 154944010 |
| Molecular Formula | C26H50O6 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.36 |
| IUPAC Name | 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid |
| SMILES | C=CC(C)CCCC(C)(C)O.CCC(COC1CCCCC1C(C)(C)C)OC=O.O=CO |
| InChI | InChI=1S/C15H28O3.C10H20O.CH2O2/c1-5-12(18-11-16)10-17-14-9-7-6-8-13(14)15(2,3)4;1-5-9(2)7-6-8-10(3,4)11;2-1-3/h11-14H,5-10H2,1-4H3;5,9,11H,1,6-8H2,2-4H3;1H,(H,2,3) |
| InChIKey | DXUXUSYJOOBILC-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid?
The IUPAC name of 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid (CID 154944010) is 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid.
What is the SMILES notation for 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid?
The canonical SMILES for 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid is C=CC(C)CCCC(C)(C)O.CCC(COC1CCCCC1C(C)(C)C)OC=O.O=CO.
What is the InChIKey of 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid?
The InChIKey is DXUXUSYJOOBILC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O3.C10H20O.CH2O2/c1-5-12(18-11-16)10-17-14-9-7-6-8-13(14)15(2,3)4;1-5-9(2)7-6-8-10(3,4)11;2-1-3/h11-14H,5-10H2,1-4H3;5,9,11H,1,6-8H2,2-4H3;1H,(H,2,3).
What are the key properties of 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid?
1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid has a molecular weight of 458.68 g/mol, XLogP of 6.01, 11 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-tert-butylcyclohexyl)oxybutan-2-yl formate;2,6-dimethyloct-7-en-2-ol;formic acid is sourced from PubChem (CID 154944010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).