About [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite
[3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite (PubChem CID 154946427) has the molecular formula C16H19NO5
and a molecular weight of 305.33 g/mol. Its IUPAC name is [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite.
Molecular Properties
| Compound Name | [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite |
| PubChem CID | 154946427 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite |
| SMILES | CC(CCON=O)CCC1Oc2cc3c(cc2O1)C(=O)CC3 |
| InChI | InChI=1S/C16H19NO5/c1-10(6-7-20-17-19)2-5-16-21-14-8-11-3-4-13(18)12(11)9-15(14)22-16/h8-10,16H,2-7H2,1H3 |
| InChIKey | CEVIXXSEQFEKMZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite?
The IUPAC name of [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite (CID 154946427) is [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite.
What is the SMILES notation for [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite?
The canonical SMILES for [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite is CC(CCON=O)CCC1Oc2cc3c(cc2O1)C(=O)CC3.
What is the InChIKey of [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite?
The InChIKey is CEVIXXSEQFEKMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO5/c1-10(6-7-20-17-19)2-5-16-21-14-8-11-3-4-13(18)12(11)9-15(14)22-16/h8-10,16H,2-7H2,1H3.
What are the key properties of [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite?
[3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite has a molecular weight of 305.33 g/mol, XLogP of 3.42, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-methyl-5-(7-oxo-5,6-dihydrocyclopenta[f][1,3]benzodioxol-2-yl)pentyl] nitrite is sourced from PubChem (CID 154946427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).