C20H19NO — CID 154946644
(4aS,10aS)-2,3-bis[(1Z)-buta-1,3-dienyl]-10,10a-dihydro-4aH-phenoxazine (PubChem CID 154946644) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is (4aS,10aS)-2,3-bis[(1Z)-buta-1,3-dienyl]-10,10a-dihydro-4aH-phenoxazine.
| Compound Name | (4aS,10aS)-2,3-bis[(1Z)-buta-1,3-dienyl]-10,10a-dihydro-4aH-phenoxazine |
|---|---|
| PubChem CID | 154946644 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (4aS,10aS)-2,3-bis[(1Z)-buta-1,3-dienyl]-10,10a-dihydro-4aH-phenoxazine |
| SMILES | C=C/C=C\C1=C[C@@H]2Nc3ccccc3O[C@H]2C=C1/C=C\C=C |
| InChI | InChI=1S/C20H19NO/c1-3-5-9-15-13-18-20(14-16(15)10-6-4-2)22-19-12-8-7-11-17(19)21-18/h3-14,18,20-21H,1-2H2/b9-5-,10-6-/t18-,20-/m0/s1 |
| InChIKey | WWJSMTIBEZIVJS-ZTABQECISA-N |
| XLogP | 4.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|