About N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide
N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide (PubChem CID 154947115) has the molecular formula C11H19F2NO2
and a molecular weight of 235.27 g/mol. Its IUPAC name is N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide.
Molecular Properties
| Compound Name | N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide |
| PubChem CID | 154947115 |
| Molecular Formula | C11H19F2NO2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)C(F)(F)C[C@@H]1CCCCO1 |
| InChI | InChI=1S/C11H19F2NO2/c1-8(14-9(2)15)11(12,13)7-10-5-3-4-6-16-10/h8,10H,3-7H2,1-2H3,(H,14,15)/t8?,10-/m0/s1 |
| InChIKey | IRAVKEZQXWHWHH-HTLJXXAVSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide?
The IUPAC name of N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide (CID 154947115) is N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide.
What is the SMILES notation for N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide?
The canonical SMILES for N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide is CC(=O)NC(C)C(F)(F)C[C@@H]1CCCCO1.
What is the InChIKey of N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide?
The InChIKey is IRAVKEZQXWHWHH-HTLJXXAVSA-N. The full InChI is InChI=1S/C11H19F2NO2/c1-8(14-9(2)15)11(12,13)7-10-5-3-4-6-16-10/h8,10H,3-7H2,1-2H3,(H,14,15)/t8?,10-/m0/s1.
What are the key properties of N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide?
N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide has a molecular weight of 235.27 g/mol, XLogP of 2.11, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3,3-difluoro-4-[(2S)-oxan-2-yl]butan-2-yl]acetamide is sourced from PubChem (CID 154947115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).