C16H24N2 — CID 154947374
1-[(2Z,4Z)-7-methyl-6-methylidenenona-2,4,8-trienyl]-1-[(3Z)-penta-1,3-dien-2-yl]hydrazine (PubChem CID 154947374) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-[(2Z,4Z)-7-methyl-6-methylidenenona-2,4,8-trienyl]-1-[(3Z)-penta-1,3-dien-2-yl]hydrazine.
| Compound Name | 1-[(2Z,4Z)-7-methyl-6-methylidenenona-2,4,8-trienyl]-1-[(3Z)-penta-1,3-dien-2-yl]hydrazine |
|---|---|
| PubChem CID | 154947374 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 1-[(2Z,4Z)-7-methyl-6-methylidenenona-2,4,8-trienyl]-1-[(3Z)-penta-1,3-dien-2-yl]hydrazine |
| SMILES | C=CC(C)C(=C)/C=C\C=C/CN(N)C(=C)/C=C\C |
| InChI | InChI=1S/C16H24N2/c1-6-11-16(5)18(17)13-10-8-9-12-15(4)14(3)7-2/h6-12,14H,2,4-5,13,17H2,1,3H3/b10-8-,11-6-,12-9- |
| InChIKey | YOFNCODBUSGAJW-JVDPZMBHSA-N |
| XLogP | 3.74 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|