About 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol
2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol (PubChem CID 154947570) has the molecular formula C13H25NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol.
Molecular Properties
| Compound Name | 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol |
| PubChem CID | 154947570 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol |
| SMILES | CC1C=C(NCCOCCO)CC(C)(C)C1 |
| InChI | InChI=1S/C13H25NO2/c1-11-8-12(10-13(2,3)9-11)14-4-6-16-7-5-15/h8,11,14-15H,4-7,9-10H2,1-3H3 |
| InChIKey | UZPUVIWUHFYYMO-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol?
The IUPAC name of 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol (CID 154947570) is 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol.
What is the SMILES notation for 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol?
The canonical SMILES for 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol is CC1C=C(NCCOCCO)CC(C)(C)C1.
What is the InChIKey of 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol?
The InChIKey is UZPUVIWUHFYYMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO2/c1-11-8-12(10-13(2,3)9-11)14-4-6-16-7-5-15/h8,11,14-15H,4-7,9-10H2,1-3H3.
What are the key properties of 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol?
2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol has a molecular weight of 227.35 g/mol, XLogP of 1.92, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(3,5,5-trimethylcyclohexen-1-yl)amino]ethoxy]ethanol is sourced from PubChem (CID 154947570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).