About N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine
N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine (PubChem CID 154947685) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine.
Molecular Properties
| Compound Name | N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine |
| PubChem CID | 154947685 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine |
| SMILES | C=N/C(=C\CCC)C1CC=CCN1C |
| InChI | InChI=1S/C12H20N2/c1-4-5-8-11(13-2)12-9-6-7-10-14(12)3/h6-8,12H,2,4-5,9-10H2,1,3H3/b11-8- |
| InChIKey | RWERJQGHVKDNPX-FLIBITNWSA-N |
| XLogP | 2.63 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine?
The IUPAC name of N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine (CID 154947685) is N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine.
What is the SMILES notation for N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine?
The canonical SMILES for N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine is C=N/C(=C\CCC)C1CC=CCN1C.
What is the InChIKey of N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine?
The InChIKey is RWERJQGHVKDNPX-FLIBITNWSA-N. The full InChI is InChI=1S/C12H20N2/c1-4-5-8-11(13-2)12-9-6-7-10-14(12)3/h6-8,12H,2,4-5,9-10H2,1,3H3/b11-8-.
What are the key properties of N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine?
N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine has a molecular weight of 192.31 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-(1-methyl-3,6-dihydro-2H-pyridin-2-yl)pent-1-enyl]methanimine is sourced from PubChem (CID 154947685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).