C12H12BrFO3 — CID 154947778
ethyl (E)-4-(4-bromo-2-fluorocyclohexa-2,4-dien-1-yl)-4-oxobut-2-enoate (PubChem CID 154947778) has the molecular formula C12H12BrFO3 and a molecular weight of 303.13 g/mol. Its IUPAC name is ethyl (E)-4-(4-bromo-2-fluorocyclohexa-2,4-dien-1-yl)-4-oxobut-2-enoate.
| Compound Name | ethyl (E)-4-(4-bromo-2-fluorocyclohexa-2,4-dien-1-yl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 154947778 |
| Molecular Formula | C12H12BrFO3 |
| Molecular Weight | 303.13 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | ethyl (E)-4-(4-bromo-2-fluorocyclohexa-2,4-dien-1-yl)-4-oxobut-2-enoate |
| SMILES | CCOC(=O)/C=C/C(=O)C1CC=C(Br)C=C1F |
| InChI | InChI=1S/C12H12BrFO3/c1-2-17-12(16)6-5-11(15)9-4-3-8(13)7-10(9)14/h3,5-7,9H,2,4H2,1H3/b6-5+ |
| InChIKey | OZAAENVFLLMJFW-AATRIKPKSA-N |
| XLogP | 2.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.13 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|