C12H17F2N3 — CID 154947834
N-(1-cyclohexylethenyl)-5-(difluoromethyl)-1H-pyrazol-4-amine (PubChem CID 154947834) has the molecular formula C12H17F2N3 and a molecular weight of 241.28 g/mol. Its IUPAC name is N-(1-cyclohexylethenyl)-5-(difluoromethyl)-1H-pyrazol-4-amine.
| Compound Name | N-(1-cyclohexylethenyl)-5-(difluoromethyl)-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 154947834 |
| Molecular Formula | C12H17F2N3 |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | N-(1-cyclohexylethenyl)-5-(difluoromethyl)-1H-pyrazol-4-amine |
| SMILES | C=C(Nc1cn[nH]c1C(F)F)C1CCCCC1 |
| InChI | InChI=1S/C12H17F2N3/c1-8(9-5-3-2-4-6-9)16-10-7-15-17-11(10)12(13)14/h7,9,12,16H,1-6H2,(H,15,17) |
| InChIKey | YXWWIGAJFYEXPQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |