C18H27N3 — CID 154948939
(1Z,3E,4E,7Z)-2-(ethylideneamino)-N,5-dimethyl-6-methylidene-9-methylimino-3-propylidenenona-1,4,7-trien-1-amine (PubChem CID 154948939) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is (1Z,3E,4E,7Z)-2-(ethylideneamino)-N,5-dimethyl-6-methylidene-9-methylimino-3-propylidenenona-1,4,7-trien-1-amine.
| Compound Name | (1Z,3E,4E,7Z)-2-(ethylideneamino)-N,5-dimethyl-6-methylidene-9-methylimino-3-propylidenenona-1,4,7-trien-1-amine |
|---|---|
| PubChem CID | 154948939 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | (1Z,3E,4E,7Z)-2-(ethylideneamino)-N,5-dimethyl-6-methylidene-9-methylimino-3-propylidenenona-1,4,7-trien-1-amine |
| SMILES | C=C(/C=C\C=N\C)/C(C)=C/C(=CCC)C(=C/NC)/N=C/C |
| InChI | InChI=1S/C18H27N3/c1-7-10-17(18(14-20-6)21-8-2)13-16(4)15(3)11-9-12-19-5/h8-14,20H,3,7H2,1-2,4-6H3/b11-9-,16-13+,17-10+,18-14-,19-12+,21-8+ |
| InChIKey | RBOZKHQPGNOYBM-DFEQNEEDSA-N |
| XLogP | 4.23 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|