About 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine
1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine (PubChem CID 154949074) has the molecular formula C17H17N3
and a molecular weight of 263.34 g/mol. Its IUPAC name is 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine |
| PubChem CID | 154949074 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine |
| SMILES | CNc1ccc(Nc2nc3ccccc3cc2C)cc1 |
| InChI | InChI=1S/C17H17N3/c1-12-11-13-5-3-4-6-16(13)20-17(12)19-15-9-7-14(18-2)8-10-15/h3-11,18H,1-2H3,(H,19,20) |
| InChIKey | CGPCGVATKPIEGJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine?
The IUPAC name of 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine (CID 154949074) is 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine.
What is the SMILES notation for 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine?
The canonical SMILES for 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine is CNc1ccc(Nc2nc3ccccc3cc2C)cc1.
What is the InChIKey of 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine?
The InChIKey is CGPCGVATKPIEGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3/c1-12-11-13-5-3-4-6-16(13)20-17(12)19-15-9-7-14(18-2)8-10-15/h3-11,18H,1-2H3,(H,19,20).
What are the key properties of 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine?
1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine has a molecular weight of 263.34 g/mol, XLogP of 4.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-methyl-4-N-(3-methylquinolin-2-yl)benzene-1,4-diamine is sourced from PubChem (CID 154949074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).