C29H42F2N4O — CID 154949248
6-[(2E,4E,6E)-5-ethyl-6-[[(2-fluoro-2-methylpropyl)-methylamino]methylidene]-2-methylocta-2,4,7-trienyl]-4-(3-fluoro-3-methylpentyl)-7H-pyrrolo[3,4-d]pyrimidin-5-one (PubChem CID 154949248) has the molecular formula C29H42F2N4O and a molecular weight of 500.68 g/mol. Its IUPAC name is 6-[(2E,4E,6E)-5-ethyl-6-[[(2-fluoro-2-methylpropyl)-methylamino]methylidene]-2-methylocta-2,4,7-trienyl]-4-(3-fluoro-3-methylpentyl)-7H-pyrrolo[3,4-d]pyrimidin-5-one.
| Compound Name | 6-[(2E,4E,6E)-5-ethyl-6-[[(2-fluoro-2-methylpropyl)-methylamino]methylidene]-2-methylocta-2,4,7-trienyl]-4-(3-fluoro-3-methylpentyl)-7H-pyrrolo[3,4-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 154949248 |
| Molecular Formula | C29H42F2N4O |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | 6-[(2E,4E,6E)-5-ethyl-6-[[(2-fluoro-2-methylpropyl)-methylamino]methylidene]-2-methylocta-2,4,7-trienyl]-4-(3-fluoro-3-methylpentyl)-7H-pyrrolo[3,4-d]pyrimidin-5-one |
| SMILES | C=CC(=C\N(C)CC(C)(C)F)/C(=C/C=C(\C)CN1Cc2ncnc(CCC(C)(F)CC)c2C1=O)CC |
| InChI | InChI=1S/C29H42F2N4O/c1-9-22(23(10-2)17-34(8)19-28(5,6)30)13-12-21(4)16-35-18-25-26(27(35)36)24(32-20-33-25)14-15-29(7,31)11-3/h10,12-13,17,20H,2,9,11,14-16,18-19H2,1,3-8H3/b21-12+,22-13+,23-17+ |
| InChIKey | HOLIWWIXUPZDAW-ZKJDFARESA-N |
| XLogP | 6.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|