C13H23NO — CID 154950332
2,2-dimethyl-3-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]oxypropan-1-amine (PubChem CID 154950332) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]oxypropan-1-amine.
| Compound Name | 2,2-dimethyl-3-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 154950332 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | 2,2-dimethyl-3-[(2E,4Z)-3-methylhepta-2,4,6-trien-2-yl]oxypropan-1-amine |
| SMILES | C=C/C=C\C(C)=C(/C)OCC(C)(C)CN |
| InChI | InChI=1S/C13H23NO/c1-6-7-8-11(2)12(3)15-10-13(4,5)9-14/h6-8H,1,9-10,14H2,2-5H3/b8-7-,12-11+ |
| InChIKey | VVCYZTMMXDFIBA-OFALOCIGSA-N |
| XLogP | 3.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|