C45H61N3O12 — CID 154950666
ethyl 4-[[3-[2,2-bis[3-(4-ethoxycarbonyl-N-methylanilino)propanoyloxymethyl]butoxy]-3-hydroxypropyl]-methylamino]benzoate (PubChem CID 154950666) has the molecular formula C45H61N3O12 and a molecular weight of 835.99 g/mol. Its IUPAC name is ethyl 4-[[3-[2,2-bis[3-(4-ethoxycarbonyl-N-methylanilino)propanoyloxymethyl]butoxy]-3-hydroxypropyl]-methylamino]benzoate.
| Compound Name | ethyl 4-[[3-[2,2-bis[3-(4-ethoxycarbonyl-N-methylanilino)propanoyloxymethyl]butoxy]-3-hydroxypropyl]-methylamino]benzoate |
|---|---|
| PubChem CID | 154950666 |
| Molecular Formula | C45H61N3O12 |
| Molecular Weight | 835.99 g/mol |
| Exact Mass | 835.43 |
| IUPAC Name | ethyl 4-[[3-[2,2-bis[3-(4-ethoxycarbonyl-N-methylanilino)propanoyloxymethyl]butoxy]-3-hydroxypropyl]-methylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(N(C)CCC(=O)OCC(CC)(COC(=O)CCN(C)c2ccc(C(=O)OCC)cc2)COC(O)CCN(C)c2ccc(C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C45H61N3O12/c1-8-45(30-58-39(49)24-27-46(5)36-18-12-33(13-19-36)42(52)55-9-2,31-59-40(50)25-28-47(6)37-20-14-34(15-21-37)43(53)56-10-3)32-60-41(51)26-29-48(7)38-22-16-35(17-23-38)44(54)57-11-4/h12-23,39,49H,8-11,24-32H2,1-7H3 |
| InChIKey | DUNZIQHWORTIDF-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 170.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.99 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|