C15H22F3N — CID 154950790
4-[(4Z)-2,6-dimethylhepta-2,4,6-trien-3-yl]-2-(trifluoromethyl)piperidine (PubChem CID 154950790) has the molecular formula C15H22F3N and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-[(4Z)-2,6-dimethylhepta-2,4,6-trien-3-yl]-2-(trifluoromethyl)piperidine.
| Compound Name | 4-[(4Z)-2,6-dimethylhepta-2,4,6-trien-3-yl]-2-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 154950790 |
| Molecular Formula | C15H22F3N |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 4-[(4Z)-2,6-dimethylhepta-2,4,6-trien-3-yl]-2-(trifluoromethyl)piperidine |
| SMILES | C=C(C)/C=C\C(=C(C)C)C1CCNC(C(F)(F)F)C1 |
| InChI | InChI=1S/C15H22F3N/c1-10(2)5-6-13(11(3)4)12-7-8-19-14(9-12)15(16,17)18/h5-6,12,14,19H,1,7-9H2,2-4H3/b6-5- |
| InChIKey | HVLNWCXJBKWGLM-WAYWQWQTSA-N |
| XLogP | 4.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|