C50H44N3PS — CID 154951407
11-(3,6-ditert-butylcarbazol-9-yl)-8,14-diphenyl-1-sulfanylidene-8,14-diaza-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 154951407) has the molecular formula C50H44N3PS and a molecular weight of 749.96 g/mol. Its IUPAC name is 11-(3,6-ditert-butylcarbazol-9-yl)-8,14-diphenyl-1-sulfanylidene-8,14-diaza-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 11-(3,6-ditert-butylcarbazol-9-yl)-8,14-diphenyl-1-sulfanylidene-8,14-diaza-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 154951407 |
| Molecular Formula | C50H44N3PS |
| Molecular Weight | 749.96 g/mol |
| Exact Mass | 749.30 |
| IUPAC Name | 11-(3,6-ditert-butylcarbazol-9-yl)-8,14-diphenyl-1-sulfanylidene-8,14-diaza-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | CC(C)(C)c1ccc2c(c1)c1cc(C(C)(C)C)ccc1n2-c1cc2c3c(c1)N(c1ccccc1)c1ccccc1P3(=S)c1ccccc1N2c1ccccc1 |
| InChI | InChI=1S/C50H44N3PS/c1-49(2,3)33-25-27-40-38(29-33)39-30-34(50(4,5)6)26-28-41(39)53(40)37-31-44-48-45(32-37)52(36-19-11-8-12-20-36)43-22-14-16-24-47(43)54(48,55)46-23-15-13-21-42(46)51(44)35-17-9-7-10-18-35/h7-32H,1-6H3 |
| InChIKey | VUNRYWJDAUMJPM-UHFFFAOYSA-N |
| XLogP | 12.70 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.96 |
| LogP ≤ 5 | 12.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|