C15H26O7 — CID 154951436
[3-(2-hydroxypropan-2-yloxy)-2-methylpropanoyl] 2,2,5-trimethyl-1,3-dioxane-5-carboxylate (PubChem CID 154951436) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is [3-(2-hydroxypropan-2-yloxy)-2-methylpropanoyl] 2,2,5-trimethyl-1,3-dioxane-5-carboxylate.
| Compound Name | [3-(2-hydroxypropan-2-yloxy)-2-methylpropanoyl] 2,2,5-trimethyl-1,3-dioxane-5-carboxylate |
|---|---|
| PubChem CID | 154951436 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | [3-(2-hydroxypropan-2-yloxy)-2-methylpropanoyl] 2,2,5-trimethyl-1,3-dioxane-5-carboxylate |
| SMILES | CC(COC(C)(C)O)C(=O)OC(=O)C1(C)COC(C)(C)OC1 |
| InChI | InChI=1S/C15H26O7/c1-10(7-19-13(2,3)18)11(16)22-12(17)15(6)8-20-14(4,5)21-9-15/h10,18H,7-9H2,1-6H3 |
| InChIKey | ACJMWDJZCKEETK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|