C19H22O6 — CID 154951443
2-[(3,5-dihydroxy-2-propylphenoxy)methyl]-4-prop-2-enylbenzene-1,3,5-triol (PubChem CID 154951443) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[(3,5-dihydroxy-2-propylphenoxy)methyl]-4-prop-2-enylbenzene-1,3,5-triol.
| Compound Name | 2-[(3,5-dihydroxy-2-propylphenoxy)methyl]-4-prop-2-enylbenzene-1,3,5-triol |
|---|---|
| PubChem CID | 154951443 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 2-[(3,5-dihydroxy-2-propylphenoxy)methyl]-4-prop-2-enylbenzene-1,3,5-triol |
| SMILES | C=CCc1c(O)cc(O)c(COc2cc(O)cc(O)c2CCC)c1O |
| InChI | InChI=1S/C19H22O6/c1-3-5-12-15(21)7-11(20)8-18(12)25-10-14-17(23)9-16(22)13(6-4-2)19(14)24/h4,7-9,20-24H,2-3,5-6,10H2,1H3 |
| InChIKey | LLZOHFJMIOIJLY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|