C8H11Cl2N — CID 154951480
(1E,3E)-1,3-dichloro-2-ethylhexa-1,3,5-trien-1-amine (PubChem CID 154951480) has the molecular formula C8H11Cl2N and a molecular weight of 192.09 g/mol. Its IUPAC name is (1E,3E)-1,3-dichloro-2-ethylhexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3E)-1,3-dichloro-2-ethylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 154951480 |
| Molecular Formula | C8H11Cl2N |
| Molecular Weight | 192.09 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | (1E,3E)-1,3-dichloro-2-ethylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(Cl)\C(CC)=C(/N)Cl |
| InChI | InChI=1S/C8H11Cl2N/c1-3-5-7(9)6(4-2)8(10)11/h3,5H,1,4,11H2,2H3/b7-5+,8-6- |
| InChIKey | QXZMBHHRDSLZJT-YMBWGVAGSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.09 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|