C26H13Br2Cl4NO4 — CID 154951958
5,7-dibromo-3,9,12,20-tetrachloro-16-[2-(2-hydroxyethoxy)ethyl]-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11,13,18,21-decaene-15,17-dione (PubChem CID 154951958) has the molecular formula C26H13Br2Cl4NO4 and a molecular weight of 705.01 g/mol. Its IUPAC name is 5,7-dibromo-3,9,12,20-tetrachloro-16-[2-(2-hydroxyethoxy)ethyl]-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11,13,18,21-decaene-15,17-dione.
| Compound Name | 5,7-dibromo-3,9,12,20-tetrachloro-16-[2-(2-hydroxyethoxy)ethyl]-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11,13,18,21-decaene-15,17-dione |
|---|---|
| PubChem CID | 154951958 |
| Molecular Formula | C26H13Br2Cl4NO4 |
| Molecular Weight | 705.01 g/mol |
| Exact Mass | 700.80 |
| IUPAC Name | 5,7-dibromo-3,9,12,20-tetrachloro-16-[2-(2-hydroxyethoxy)ethyl]-16-azahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11,13,18,21-decaene-15,17-dione |
| SMILES | O=C1c2cc(Cl)c3c4c(Cl)cc(Br)c5c(Br)cc(Cl)c(c6c(Cl)cc(c2c36)C(=O)N1CCOCCO)c54 |
| InChI | InChI=1S/C26H13Br2Cl4NO4/c27-11-7-15(31)21-19-13(29)5-9-17-10(26(36)33(25(9)35)1-3-37-4-2-34)6-14(30)20(23(17)19)22-16(32)8-12(28)18(11)24(21)22/h5-8,34H,1-4H2 |
| InChIKey | GXWNEGPFNQAAEN-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.01 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|