About 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine
4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine (PubChem CID 154952981) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine.
Molecular Properties
| Compound Name | 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine |
| PubChem CID | 154952981 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine |
| SMILES | C/C=C(/C(C)(C)C)C1(NCC)CCOCC1 |
| InChI | InChI=1S/C14H27NO/c1-6-12(13(3,4)5)14(15-7-2)8-10-16-11-9-14/h6,15H,7-11H2,1-5H3/b12-6- |
| InChIKey | WDPFONLOJLSXLO-SDQBBNPISA-N |
| XLogP | 3.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine?
The IUPAC name of 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine (CID 154952981) is 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine.
What is the SMILES notation for 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine?
The canonical SMILES for 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine is C/C=C(/C(C)(C)C)C1(NCC)CCOCC1.
What is the InChIKey of 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine?
The InChIKey is WDPFONLOJLSXLO-SDQBBNPISA-N. The full InChI is InChI=1S/C14H27NO/c1-6-12(13(3,4)5)14(15-7-2)8-10-16-11-9-14/h6,15H,7-11H2,1-5H3/b12-6-.
What are the key properties of 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine?
4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine has a molecular weight of 225.38 g/mol, XLogP of 3.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-4,4-dimethylpent-2-en-3-yl]-N-ethyloxan-4-amine is sourced from PubChem (CID 154952981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).