C15H19N3S — CID 154953173
(1Z)-3-N-(1,3-benzothiazol-5-yl)-1-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine (PubChem CID 154953173) has the molecular formula C15H19N3S and a molecular weight of 273.41 g/mol. Its IUPAC name is (1Z)-3-N-(1,3-benzothiazol-5-yl)-1-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine.
| Compound Name | (1Z)-3-N-(1,3-benzothiazol-5-yl)-1-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine |
|---|---|
| PubChem CID | 154953173 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | (1Z)-3-N-(1,3-benzothiazol-5-yl)-1-N-methyl-1-N-propan-2-ylbuta-1,3-diene-1,3-diamine |
| SMILES | C=C(/C=C\N(C)C(C)C)Nc1ccc2scnc2c1 |
| InChI | InChI=1S/C15H19N3S/c1-11(2)18(4)8-7-12(3)17-13-5-6-15-14(9-13)16-10-19-15/h5-11,17H,3H2,1-2,4H3/b8-7- |
| InChIKey | XWQDYCLURGZXBG-FPLPWBNLSA-N |
| XLogP | 4.08 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|