C26H32N2O2 — CID 154953359
3-[(2E,4E)-4-[5-[(1Z)-buta-1,3-dienyl]-6-ethenyl-2,4-dihydro-1,3-oxazin-3-yl]hepta-2,4,6-trien-2-yl]-5-ethenyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine (PubChem CID 154953359) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is 3-[(2E,4E)-4-[5-[(1Z)-buta-1,3-dienyl]-6-ethenyl-2,4-dihydro-1,3-oxazin-3-yl]hepta-2,4,6-trien-2-yl]-5-ethenyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine.
| Compound Name | 3-[(2E,4E)-4-[5-[(1Z)-buta-1,3-dienyl]-6-ethenyl-2,4-dihydro-1,3-oxazin-3-yl]hepta-2,4,6-trien-2-yl]-5-ethenyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine |
|---|---|
| PubChem CID | 154953359 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 3-[(2E,4E)-4-[5-[(1Z)-buta-1,3-dienyl]-6-ethenyl-2,4-dihydro-1,3-oxazin-3-yl]hepta-2,4,6-trien-2-yl]-5-ethenyl-6-[(Z)-prop-1-enyl]-2,4-dihydro-1,3-oxazine |
| SMILES | C=C/C=C\C1=C(C=C)OCN(C(/C=C(\C)N2COC(/C=C\C)=C(C=C)C2)=C/C=C)C1 |
| InChI | InChI=1S/C26H32N2O2/c1-7-12-15-23-18-28(20-29-25(23)11-5)24(13-8-2)16-21(6)27-17-22(10-4)26(14-9-3)30-19-27/h7-16H,1-2,4-5,17-20H2,3,6H3/b14-9-,15-12-,21-16+,24-13+ |
| InChIKey | KFDOFTWTTBAGBB-VRSYQJRESA-N |
| XLogP | 5.74 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|