About 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole
1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole (PubChem CID 154953410) has the molecular formula C10H11F3N2
and a molecular weight of 216.21 g/mol. Its IUPAC name is 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole.
Molecular Properties
| Compound Name | 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole |
| PubChem CID | 154953410 |
| Molecular Formula | C10H11F3N2 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole |
| SMILES | C=C/C=C(\C)c1cn(C)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C10H11F3N2/c1-4-5-7(2)8-6-15(3)9(14-8)10(11,12)13/h4-6H,1H2,2-3H3/b7-5+ |
| InChIKey | MLUJUZUHWWJVSP-FNORWQNLSA-N |
| XLogP | 3.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole?
The IUPAC name of 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole (CID 154953410) is 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole.
What is the SMILES notation for 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole?
The canonical SMILES for 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole is C=C/C=C(\C)c1cn(C)c(C(F)(F)F)n1.
What is the InChIKey of 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole?
The InChIKey is MLUJUZUHWWJVSP-FNORWQNLSA-N. The full InChI is InChI=1S/C10H11F3N2/c1-4-5-7(2)8-6-15(3)9(14-8)10(11,12)13/h4-6H,1H2,2-3H3/b7-5+.
What are the key properties of 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole?
1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole has a molecular weight of 216.21 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(2E)-penta-2,4-dien-2-yl]-2-(trifluoromethyl)imidazole is sourced from PubChem (CID 154953410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).