About 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole
1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole (PubChem CID 154953429) has the molecular formula C11H13F3N2
and a molecular weight of 230.23 g/mol. Its IUPAC name is 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole.
Molecular Properties
| Compound Name | 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole |
| PubChem CID | 154953429 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole |
| SMILES | C=C/C=C(\C)c1nc(C(F)(F)F)cn1CC |
| InChI | InChI=1S/C11H13F3N2/c1-4-6-8(3)10-15-9(11(12,13)14)7-16(10)5-2/h4,6-7H,1,5H2,2-3H3/b8-6+ |
| InChIKey | NZTZQDNRSWLPQX-SOFGYWHQSA-N |
| XLogP | 3.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole?
The IUPAC name of 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole (CID 154953429) is 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole.
What is the SMILES notation for 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole?
The canonical SMILES for 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole is C=C/C=C(\C)c1nc(C(F)(F)F)cn1CC.
What is the InChIKey of 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole?
The InChIKey is NZTZQDNRSWLPQX-SOFGYWHQSA-N. The full InChI is InChI=1S/C11H13F3N2/c1-4-6-8(3)10-15-9(11(12,13)14)7-16(10)5-2/h4,6-7H,1,5H2,2-3H3/b8-6+.
What are the key properties of 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole?
1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole has a molecular weight of 230.23 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-[(2E)-penta-2,4-dien-2-yl]-4-(trifluoromethyl)imidazole is sourced from PubChem (CID 154953429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).