About 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol
2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol (PubChem CID 154953448) has the molecular formula C7H13F3N2O
and a molecular weight of 198.19 g/mol. Its IUPAC name is 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol.
Molecular Properties
| Compound Name | 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol |
| PubChem CID | 154953448 |
| Molecular Formula | C7H13F3N2O |
| Molecular Weight | 198.19 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol |
| SMILES | CN/C(=C\NC(C)CO)C(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O/c1-5(4-13)12-3-6(11-2)7(8,9)10/h3,5,11-13H,4H2,1-2H3/b6-3- |
| InChIKey | CYLMOHCDNAGTSU-UTCJRWHESA-N |
| XLogP | 0.58 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol?
The IUPAC name of 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol (CID 154953448) is 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol.
What is the SMILES notation for 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol?
The canonical SMILES for 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol is CN/C(=C\NC(C)CO)C(F)(F)F.
What is the InChIKey of 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol?
The InChIKey is CYLMOHCDNAGTSU-UTCJRWHESA-N. The full InChI is InChI=1S/C7H13F3N2O/c1-5(4-13)12-3-6(11-2)7(8,9)10/h3,5,11-13H,4H2,1-2H3/b6-3-.
What are the key properties of 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol?
2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol has a molecular weight of 198.19 g/mol, XLogP of 0.58, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(Z)-3,3,3-trifluoro-2-(methylamino)prop-1-enyl]amino]propan-1-ol is sourced from PubChem (CID 154953448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).