C20H33NO2S — CID 154953602
ethyl 4-methyl-3-propan-2-yl-2-[(2,4,6-trimethylphenyl)sulfanylamino]pentanoate (PubChem CID 154953602) has the molecular formula C20H33NO2S and a molecular weight of 351.56 g/mol. Its IUPAC name is ethyl 4-methyl-3-propan-2-yl-2-[(2,4,6-trimethylphenyl)sulfanylamino]pentanoate.
| Compound Name | ethyl 4-methyl-3-propan-2-yl-2-[(2,4,6-trimethylphenyl)sulfanylamino]pentanoate |
|---|---|
| PubChem CID | 154953602 |
| Molecular Formula | C20H33NO2S |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | ethyl 4-methyl-3-propan-2-yl-2-[(2,4,6-trimethylphenyl)sulfanylamino]pentanoate |
| SMILES | CCOC(=O)C(NSc1c(C)cc(C)cc1C)C(C(C)C)C(C)C |
| InChI | InChI=1S/C20H33NO2S/c1-9-23-20(22)18(17(12(2)3)13(4)5)21-24-19-15(7)10-14(6)11-16(19)8/h10-13,17-18,21H,9H2,1-8H3 |
| InChIKey | BOGZIHWPICGSEB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|