C26H47N3 — CID 154953741
N'-(5,5-dimethylhept-6-enyl)-N-methyl-N'-[(5-pent-1-en-2-yl-2-prop-1-en-2-yl-1,2,3,4-tetrahydropyridin-6-yl)methyl]ethane-1,2-diamine (PubChem CID 154953741) has the molecular formula C26H47N3 and a molecular weight of 401.68 g/mol. Its IUPAC name is N'-(5,5-dimethylhept-6-enyl)-N-methyl-N'-[(5-pent-1-en-2-yl-2-prop-1-en-2-yl-1,2,3,4-tetrahydropyridin-6-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-(5,5-dimethylhept-6-enyl)-N-methyl-N'-[(5-pent-1-en-2-yl-2-prop-1-en-2-yl-1,2,3,4-tetrahydropyridin-6-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 154953741 |
| Molecular Formula | C26H47N3 |
| Molecular Weight | 401.68 g/mol |
| Exact Mass | 401.38 |
| IUPAC Name | N'-(5,5-dimethylhept-6-enyl)-N-methyl-N'-[(5-pent-1-en-2-yl-2-prop-1-en-2-yl-1,2,3,4-tetrahydropyridin-6-yl)methyl]ethane-1,2-diamine |
| SMILES | C=CC(C)(C)CCCCN(CCNC)CC1=C(C(=C)CCC)CCC(C(=C)C)N1 |
| InChI | InChI=1S/C26H47N3/c1-9-13-22(5)23-14-15-24(21(3)4)28-25(23)20-29(19-17-27-8)18-12-11-16-26(6,7)10-2/h10,24,27-28H,2-3,5,9,11-20H2,1,4,6-8H3 |
| InChIKey | GAFBUDSUFGDYDH-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.68 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|