C22H29N5O3S2 — CID 154953852
methyl 2-[[2-(2,2-dimethyl-3-oxopropyl)-3-sulfanylidene-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-7-yl]methyl]-6-(1,3-thiazol-2-yl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 154953852) has the molecular formula C22H29N5O3S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is methyl 2-[[2-(2,2-dimethyl-3-oxopropyl)-3-sulfanylidene-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-7-yl]methyl]-6-(1,3-thiazol-2-yl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 2-[[2-(2,2-dimethyl-3-oxopropyl)-3-sulfanylidene-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-7-yl]methyl]-6-(1,3-thiazol-2-yl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 154953852 |
| Molecular Formula | C22H29N5O3S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | methyl 2-[[2-(2,2-dimethyl-3-oxopropyl)-3-sulfanylidene-5,6,8,8a-tetrahydro-1H-imidazo[1,5-a]pyrazin-7-yl]methyl]-6-(1,3-thiazol-2-yl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1=C(CN2CCN3C(=S)N(CC(C)(C)C=O)CC3C2)NC(c2nccs2)=CC1 |
| InChI | InChI=1S/C22H29N5O3S2/c1-22(2,14-28)13-26-11-15-10-25(7-8-27(15)21(26)31)12-18-16(20(29)30-3)4-5-17(24-18)19-23-6-9-32-19/h5-6,9,14-15,24H,4,7-8,10-13H2,1-3H3 |
| InChIKey | DKXUFEGLOSGRIE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|