C14H8ClFN2O2S — CID 154954820
2-[5-(3-chloro-4-fluorophenyl)-4-oxothieno[3,4-d]pyrimidin-3-yl]acetaldehyde (PubChem CID 154954820) has the molecular formula C14H8ClFN2O2S and a molecular weight of 322.75 g/mol. Its IUPAC name is 2-[5-(3-chloro-4-fluorophenyl)-4-oxothieno[3,4-d]pyrimidin-3-yl]acetaldehyde.
| Compound Name | 2-[5-(3-chloro-4-fluorophenyl)-4-oxothieno[3,4-d]pyrimidin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 154954820 |
| Molecular Formula | C14H8ClFN2O2S |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-[5-(3-chloro-4-fluorophenyl)-4-oxothieno[3,4-d]pyrimidin-3-yl]acetaldehyde |
| SMILES | O=CCn1cnc2csc(-c3ccc(F)c(Cl)c3)c2c1=O |
| InChI | InChI=1S/C14H8ClFN2O2S/c15-9-5-8(1-2-10(9)16)13-12-11(6-21-13)17-7-18(3-4-19)14(12)20/h1-2,4-7H,3H2 |
| InChIKey | QVKFFBHOVDJSDN-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|